C21H34N2O6 — CID 142059147
ditert-butyl (2R,4S,5R)-5-[(1R)-1-acetamido-2-oxoethyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 142059147) has the molecular formula C21H34N2O6 and a molecular weight of 410.51 g/mol. Its IUPAC name is ditert-butyl (2R,4S,5R)-5-[(1R)-1-acetamido-2-oxoethyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,4S,5R)-5-[(1R)-1-acetamido-2-oxoethyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142059147 |
| Molecular Formula | C21H34N2O6 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | ditert-butyl (2R,4S,5R)-5-[(1R)-1-acetamido-2-oxoethyl]-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | C/C=C\[C@@H]1C[C@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1[C@H](C=O)NC(C)=O |
| InChI | InChI=1S/C21H34N2O6/c1-9-10-14-11-16(18(26)28-20(3,4)5)23(19(27)29-21(6,7)8)17(14)15(12-24)22-13(2)25/h9-10,12,14-17H,11H2,1-8H3,(H,22,25)/b10-9-/t14-,15+,16-,17-/m1/s1 |
| InChIKey | KMCGISIGJXAAGG-PVFHNOOTSA-N |
| XLogP | 2.60 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|