C25H40N2O8 — CID 91179028
ditert-butyl (4R,5R)-5-[(2S)-2-[acetamido(methoxy)methoxy]butyl]-4-prop-2-ynoylpyrrolidine-1,2-dicarboxylate (PubChem CID 91179028) has the molecular formula C25H40N2O8 and a molecular weight of 496.60 g/mol. Its IUPAC name is ditert-butyl (4R,5R)-5-[(2S)-2-[acetamido(methoxy)methoxy]butyl]-4-prop-2-ynoylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (4R,5R)-5-[(2S)-2-[acetamido(methoxy)methoxy]butyl]-4-prop-2-ynoylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91179028 |
| Molecular Formula | C25H40N2O8 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | ditert-butyl (4R,5R)-5-[(2S)-2-[acetamido(methoxy)methoxy]butyl]-4-prop-2-ynoylpyrrolidine-1,2-dicarboxylate |
| SMILES | C#CC(=O)[C@@H]1CC(C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@@H]1C[C@H](CC)OC(NC(C)=O)OC |
| InChI | InChI=1S/C25H40N2O8/c1-11-16(33-22(32-10)26-15(3)28)13-18-17(20(29)12-2)14-19(21(30)34-24(4,5)6)27(18)23(31)35-25(7,8)9/h2,16-19,22H,11,13-14H2,1,3-10H3,(H,26,28)/t16-,17+,18+,19?,22?/m0/s1 |
| InChIKey | GJZCLYDIOLXUST-RLTPUUANSA-N |
| XLogP | 2.78 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|