C25H46N2O7 — CID 20744575
tert-butyl 2-(1-acetamido-2-ethyl-2-methoxybutyl)-5-acetyl-3-(1-ethoxyethoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 20744575) has the molecular formula C25H46N2O7 and a molecular weight of 486.65 g/mol. Its IUPAC name is tert-butyl 2-(1-acetamido-2-ethyl-2-methoxybutyl)-5-acetyl-3-(1-ethoxyethoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(1-acetamido-2-ethyl-2-methoxybutyl)-5-acetyl-3-(1-ethoxyethoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 20744575 |
| Molecular Formula | C25H46N2O7 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | tert-butyl 2-(1-acetamido-2-ethyl-2-methoxybutyl)-5-acetyl-3-(1-ethoxyethoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(C)OCC1CC(C(C)=O)N(C(=O)OC(C)(C)C)C1C(NC(C)=O)C(CC)(CC)OC |
| InChI | InChI=1S/C25H46N2O7/c1-11-25(12-2,31-10)22(26-17(5)29)21-19(15-33-18(6)32-13-3)14-20(16(4)28)27(21)23(30)34-24(7,8)9/h18-22H,11-15H2,1-10H3,(H,26,29) |
| InChIKey | DNNICDBMYMDVKO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|