C21H31NO7 — CID 11795786
tert-butyl (2R,3S)-3-benzoyloxy-2-(1-ethoxyethoxymethyl)-5-hydroxypyrrolidine-1-carboxylate (PubChem CID 11795786) has the molecular formula C21H31NO7 and a molecular weight of 409.48 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-benzoyloxy-2-(1-ethoxyethoxymethyl)-5-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-benzoyloxy-2-(1-ethoxyethoxymethyl)-5-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11795786 |
| Molecular Formula | C21H31NO7 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | tert-butyl (2R,3S)-3-benzoyloxy-2-(1-ethoxyethoxymethyl)-5-hydroxypyrrolidine-1-carboxylate |
| SMILES | CCOC(C)OC[C@@H]1[C@@H](OC(=O)c2ccccc2)CC(O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31NO7/c1-6-26-14(2)27-13-16-17(28-19(24)15-10-8-7-9-11-15)12-18(23)22(16)20(25)29-21(3,4)5/h7-11,14,16-18,23H,6,12-13H2,1-5H3/t14?,16-,17+,18?/m1/s1 |
| InChIKey | ZXKVJDRTCJSUEA-MKFDVMFOSA-N |
| XLogP | 2.94 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|