C16H21NO5 — CID 10518800
[(2R,3S)-2-(1-ethoxyethoxymethyl)-5-oxopyrrolidin-3-yl] benzoate (PubChem CID 10518800) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is [(2R,3S)-2-(1-ethoxyethoxymethyl)-5-oxopyrrolidin-3-yl] benzoate.
| Compound Name | [(2R,3S)-2-(1-ethoxyethoxymethyl)-5-oxopyrrolidin-3-yl] benzoate |
|---|---|
| PubChem CID | 10518800 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | [(2R,3S)-2-(1-ethoxyethoxymethyl)-5-oxopyrrolidin-3-yl] benzoate |
| SMILES | CCOC(C)OC[C@H]1NC(=O)C[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21NO5/c1-3-20-11(2)21-10-13-14(9-15(18)17-13)22-16(19)12-7-5-4-6-8-12/h4-8,11,13-14H,3,9-10H2,1-2H3,(H,17,18)/t11?,13-,14+/m1/s1 |
| InChIKey | QMYGHEZASNTRRX-WLPIGLKUSA-N |
| XLogP | 1.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|