C24H26O7 — CID 23251981
[(3R,4S)-4-benzoyloxy-6-(diethoxymethyl)-3,4-dihydro-2H-pyran-3-yl] benzoate (PubChem CID 23251981) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is [(3R,4S)-4-benzoyloxy-6-(diethoxymethyl)-3,4-dihydro-2H-pyran-3-yl] benzoate.
| Compound Name | [(3R,4S)-4-benzoyloxy-6-(diethoxymethyl)-3,4-dihydro-2H-pyran-3-yl] benzoate |
|---|---|
| PubChem CID | 23251981 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [(3R,4S)-4-benzoyloxy-6-(diethoxymethyl)-3,4-dihydro-2H-pyran-3-yl] benzoate |
| SMILES | CCOC(OCC)C1=C[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)CO1 |
| InChI | InChI=1S/C24H26O7/c1-3-27-24(28-4-2)20-15-19(30-22(25)17-11-7-5-8-12-17)21(16-29-20)31-23(26)18-13-9-6-10-14-18/h5-15,19,21,24H,3-4,16H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | PLLSZUOUPZHUKP-PZJWPPBQSA-N |
| XLogP | 3.75 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|