C22H32N2O5 — CID 154708926
tert-butyl (2S,3R)-2-[(1R)-1-benzoyloxy-2-(tert-butylamino)-2-oxoethyl]-3-ethylaziridine-1-carboxylate (PubChem CID 154708926) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-[(1R)-1-benzoyloxy-2-(tert-butylamino)-2-oxoethyl]-3-ethylaziridine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-[(1R)-1-benzoyloxy-2-(tert-butylamino)-2-oxoethyl]-3-ethylaziridine-1-carboxylate |
|---|---|
| PubChem CID | 154708926 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | tert-butyl (2S,3R)-2-[(1R)-1-benzoyloxy-2-(tert-butylamino)-2-oxoethyl]-3-ethylaziridine-1-carboxylate |
| SMILES | CC[C@@H]1[C@@H]([C@@H](OC(=O)c2ccccc2)C(=O)NC(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32N2O5/c1-8-15-16(24(15)20(27)29-22(5,6)7)17(18(25)23-21(2,3)4)28-19(26)14-12-10-9-11-13-14/h9-13,15-17H,8H2,1-7H3,(H,23,25)/t15-,16+,17-,24?/m1/s1 |
| InChIKey | YBBXCKDSNDNLGG-YMBBDDSLSA-N |
| XLogP | 3.52 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|