C27H40N2O5 — CID 154708934
tert-butyl (2S,3R)-2-[(1S)-1-benzoyloxy-2-(cyclohexylamino)-2-oxoethyl]-3-pentylaziridine-1-carboxylate (PubChem CID 154708934) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-[(1S)-1-benzoyloxy-2-(cyclohexylamino)-2-oxoethyl]-3-pentylaziridine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-[(1S)-1-benzoyloxy-2-(cyclohexylamino)-2-oxoethyl]-3-pentylaziridine-1-carboxylate |
|---|---|
| PubChem CID | 154708934 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | tert-butyl (2S,3R)-2-[(1S)-1-benzoyloxy-2-(cyclohexylamino)-2-oxoethyl]-3-pentylaziridine-1-carboxylate |
| SMILES | CCCCC[C@@H]1[C@@H]([C@H](OC(=O)c2ccccc2)C(=O)NC2CCCCC2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H40N2O5/c1-5-6-9-18-21-22(29(21)26(32)34-27(2,3)4)23(24(30)28-20-16-12-8-13-17-20)33-25(31)19-14-10-7-11-15-19/h7,10-11,14-15,20-23H,5-6,8-9,12-13,16-18H2,1-4H3,(H,28,30)/t21-,22+,23+,29?/m1/s1 |
| InChIKey | FNGGFWFVGBZUOL-JACYWDGTSA-N |
| XLogP | 5.23 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|