C19H23NO4 — CID 86662915
tert-butyl (2R,3R)-3-benzoyloxy-2-prop-2-ynylpyrrolidine-1-carboxylate (PubChem CID 86662915) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-benzoyloxy-2-prop-2-ynylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-benzoyloxy-2-prop-2-ynylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86662915 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | tert-butyl (2R,3R)-3-benzoyloxy-2-prop-2-ynylpyrrolidine-1-carboxylate |
| SMILES | C#CC[C@@H]1[C@H](OC(=O)c2ccccc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H23NO4/c1-5-9-15-16(23-17(21)14-10-7-6-8-11-14)12-13-20(15)18(22)24-19(2,3)4/h1,6-8,10-11,15-16H,9,12-13H2,2-4H3/t15-,16-/m1/s1 |
| InChIKey | HPQJJCIEEXKCJW-HZPDHXFCSA-N |
| XLogP | 3.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|