C25H39N3O4 — CID 159233316
tert-butyl (2R,3S,5S)-5-isocyano-2-[(1R,2S)-2-methoxy-2-methyl-1-(pent-4-ynoylamino)pentyl]-3-[(Z)-prop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 159233316) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is tert-butyl (2R,3S,5S)-5-isocyano-2-[(1R,2S)-2-methoxy-2-methyl-1-(pent-4-ynoylamino)pentyl]-3-[(Z)-prop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,5S)-5-isocyano-2-[(1R,2S)-2-methoxy-2-methyl-1-(pent-4-ynoylamino)pentyl]-3-[(Z)-prop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 159233316 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | tert-butyl (2R,3S,5S)-5-isocyano-2-[(1R,2S)-2-methoxy-2-methyl-1-(pent-4-ynoylamino)pentyl]-3-[(Z)-prop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | [C-]#[N+][C@H]1C[C@@H](/C=C\C)[C@H]([C@@H](NC(=O)CCC#C)[C@](C)(CCC)OC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H39N3O4/c1-10-13-15-20(29)27-22(25(7,31-9)16-12-3)21-18(14-11-2)17-19(26-8)28(21)23(30)32-24(4,5)6/h1,11,14,18-19,21-22H,12-13,15-17H2,2-7,9H3,(H,27,29)/b14-11-/t18-,19-,21-,22-,25+/m1/s1 |
| InChIKey | RJHFZOQRBKWTKF-LGMPMUEHSA-N |
| XLogP | 4.54 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|