C16H30N2O2 — CID 91036341
N-[(1R,2S)-2-methoxy-2-methyl-1-[(2R,3S)-3-prop-1-enylpyrrolidin-2-yl]pentyl]acetamide (PubChem CID 91036341) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[(1R,2S)-2-methoxy-2-methyl-1-[(2R,3S)-3-prop-1-enylpyrrolidin-2-yl]pentyl]acetamide.
| Compound Name | N-[(1R,2S)-2-methoxy-2-methyl-1-[(2R,3S)-3-prop-1-enylpyrrolidin-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 91036341 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | N-[(1R,2S)-2-methoxy-2-methyl-1-[(2R,3S)-3-prop-1-enylpyrrolidin-2-yl]pentyl]acetamide |
| SMILES | CC=C[C@@H]1CCN[C@H]1[C@@H](NC(C)=O)[C@](C)(CCC)OC |
| InChI | InChI=1S/C16H30N2O2/c1-6-8-13-9-11-17-14(13)15(18-12(3)19)16(4,20-5)10-7-2/h6,8,13-15,17H,7,9-11H2,1-5H3,(H,18,19)/t13-,14-,15-,16+/m1/s1 |
| InChIKey | QDJOJYDALXFMBH-FPCVCCKLSA-N |
| XLogP | 2.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|