C18H32N2O3 — CID 57036124
ethyl (2S,4S,5R)-5-[(1S)-1-acetamido-2-ethylbutyl]-4-prop-1-enylpyrrolidine-2-carboxylate (PubChem CID 57036124) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is ethyl (2S,4S,5R)-5-[(1S)-1-acetamido-2-ethylbutyl]-4-prop-1-enylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,4S,5R)-5-[(1S)-1-acetamido-2-ethylbutyl]-4-prop-1-enylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57036124 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | ethyl (2S,4S,5R)-5-[(1S)-1-acetamido-2-ethylbutyl]-4-prop-1-enylpyrrolidine-2-carboxylate |
| SMILES | CC=C[C@@H]1C[C@@H](C(=O)OCC)N[C@H]1[C@@H](NC(C)=O)C(CC)CC |
| InChI | InChI=1S/C18H32N2O3/c1-6-10-14-11-15(18(22)23-9-4)20-17(14)16(19-12(5)21)13(7-2)8-3/h6,10,13-17,20H,7-9,11H2,1-5H3,(H,19,21)/t14-,15+,16+,17-/m1/s1 |
| InChIKey | HBWFHVVTPKUKQA-LTIDMASMSA-N |
| XLogP | 2.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|