C20H35F3N4O5 — CID 20586294
ethyl (1R,3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-[(2-methylhydrazinyl)methylideneamino]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 20586294) has the molecular formula C20H35F3N4O5 and a molecular weight of 468.52 g/mol. Its IUPAC name is ethyl (1R,3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-[(2-methylhydrazinyl)methylideneamino]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl (1R,3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-[(2-methylhydrazinyl)methylideneamino]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 20586294 |
| Molecular Formula | C20H35F3N4O5 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | ethyl (1R,3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-[(2-methylhydrazinyl)methylideneamino]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]([C@@H](NC(C)=O)C(CC)CC)[C@H](/N=C/NNC)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H34N4O3.C2HF3O2/c1-6-13(7-2)17(22-12(4)23)15-9-14(18(24)25-8-3)10-16(15)20-11-21-19-5;3-2(4,5)1(6)7/h11,13-17,19H,6-10H2,1-5H3,(H,20,21)(H,22,23);(H,6,7)/t14-,15-,16-,17+;/m1./s1 |
| InChIKey | HMHGBCAFKBSNEE-COQBOHPESA-N |
| XLogP | 2.27 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|