C29H52N4O7 — CID 163716199
ethyl (1R,3S,4R)-3-(1-acetamido-2-propylpentyl)-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]cyclopentane-1-carboxylate (PubChem CID 163716199) has the molecular formula C29H52N4O7 and a molecular weight of 568.76 g/mol. Its IUPAC name is ethyl (1R,3S,4R)-3-(1-acetamido-2-propylpentyl)-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]cyclopentane-1-carboxylate.
| Compound Name | ethyl (1R,3S,4R)-3-(1-acetamido-2-propylpentyl)-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 163716199 |
| Molecular Formula | C29H52N4O7 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.38 |
| IUPAC Name | ethyl (1R,3S,4R)-3-(1-acetamido-2-propylpentyl)-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]cyclopentane-1-carboxylate |
| SMILES | CCCC(CCC)C(NC(C)=O)[C@@H]1C[C@@H](C(=O)OCC)C[C@H]1N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H52N4O7/c1-11-14-19(15-12-2)23(30-18(4)34)21-16-20(24(35)38-13-3)17-22(21)31-25(32-26(36)39-28(5,6)7)33-27(37)40-29(8,9)10/h19-23H,11-17H2,1-10H3,(H,30,34)(H2,31,32,33,36,37)/t20-,21-,22-,23?/m1/s1 |
| InChIKey | KNOFJJRFMWTDLY-YRNFEDNZSA-N |
| XLogP | 5.07 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|