C18H33N5O5 — CID 160633337
(1S,2S,3S,4R)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-(diaminomethylideneamino)-2-(ethylcarbamoyloxy)cyclopentane-1-carboxylic acid (PubChem CID 160633337) has the molecular formula C18H33N5O5 and a molecular weight of 399.49 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-(diaminomethylideneamino)-2-(ethylcarbamoyloxy)cyclopentane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-(diaminomethylideneamino)-2-(ethylcarbamoyloxy)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 160633337 |
| Molecular Formula | C18H33N5O5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | (1S,2S,3S,4R)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-(diaminomethylideneamino)-2-(ethylcarbamoyloxy)cyclopentane-1-carboxylic acid |
| SMILES | CCNC(=O)O[C@H]1[C@@H]([C@H](NC(C)=O)C(CC)CC)[C@H](N=C(N)N)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C18H33N5O5/c1-5-10(6-2)14(22-9(4)24)13-12(23-17(19)20)8-11(16(25)26)15(13)28-18(27)21-7-3/h10-15H,5-8H2,1-4H3,(H,21,27)(H,22,24)(H,25,26)(H4,19,20,23)/t11-,12+,13+,14+,15+/m0/s1 |
| InChIKey | RIFBDULZRJONGQ-NJVJYBDUSA-N |
| XLogP | 0.40 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|