C14H24IN5O8 — CID 166677140
(1S,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-(iodocarbamoyloxy)cyclopentane-1-carboxylic acid (PubChem CID 166677140) has the molecular formula C14H24IN5O8 and a molecular weight of 517.28 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-(iodocarbamoyloxy)cyclopentane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-(iodocarbamoyloxy)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 166677140 |
| Molecular Formula | C14H24IN5O8 |
| Molecular Weight | 517.28 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | (1S,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-(iodocarbamoyloxy)cyclopentane-1-carboxylic acid |
| SMILES | CC(=O)N[C@H]([C@@H](O)[C@@H](O)CO)[C@@H]1[C@H](OC(=O)NI)[C@@H](C(=O)O)C[C@H]1N=C(N)N |
| InChI | InChI=1S/C14H24IN5O8/c1-4(22)18-9(10(24)7(23)3-21)8-6(19-13(16)17)2-5(12(25)26)11(8)28-14(27)20-15/h5-11,21,23-24H,2-3H2,1H3,(H,18,22)(H,20,27)(H,25,26)(H4,16,17,19)/t5-,6+,7-,8+,9-,10-,11+/m0/s1 |
| InChIKey | JNLXGVTYGXXORJ-GEPBSXRESA-N |
| XLogP | -2.99 |
| TPSA | 229.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.28 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|