C13H24IN5O6 — CID 166676968
(1S,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-(iodoamino)cyclopentane-1-carboxylic acid (PubChem CID 166676968) has the molecular formula C13H24IN5O6 and a molecular weight of 473.27 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-(iodoamino)cyclopentane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-(iodoamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 166676968 |
| Molecular Formula | C13H24IN5O6 |
| Molecular Weight | 473.27 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | (1S,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-(iodoamino)cyclopentane-1-carboxylic acid |
| SMILES | CC(=O)N[C@H]([C@@H](O)[C@@H](O)CO)[C@@H]1[C@H](NI)[C@@H](C(=O)O)C[C@H]1N=C(N)N |
| InChI | InChI=1S/C13H24IN5O6/c1-4(21)17-10(11(23)7(22)3-20)8-6(18-13(15)16)2-5(12(24)25)9(8)19-14/h5-11,19-20,22-23H,2-3H2,1H3,(H,17,21)(H,24,25)(H4,15,16,18)/t5-,6+,7-,8-,9+,10-,11-/m0/s1 |
| InChIKey | MOXZRYZXCLUGSO-QQGNAPQASA-N |
| XLogP | -3.12 |
| TPSA | 203.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.27 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|