C17H32N4O4 — CID 165178809
ethyl (1S,2S,3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylate (PubChem CID 165178809) has the molecular formula C17H32N4O4 and a molecular weight of 356.47 g/mol. Its IUPAC name is ethyl (1S,2S,3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylate.
| Compound Name | ethyl (1S,2S,3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 165178809 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | ethyl (1S,2S,3S,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](N=C(N)N)[C@H]([C@@H](NC(C)=O)C(CC)CC)[C@@H]1O |
| InChI | InChI=1S/C17H32N4O4/c1-5-10(6-2)14(20-9(4)22)13-12(21-17(18)19)8-11(15(13)23)16(24)25-7-3/h10-15,23H,5-8H2,1-4H3,(H,20,22)(H4,18,19,21)/t11-,12+,13+,14-,15+/m0/s1 |
| InChIKey | LJGDGUBHGKUDSL-VYDRJRHOSA-N |
| XLogP | 0.13 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|