C13H26N4O3 — CID 24876038
(1S,2S,3S,4R)-3-[(1S)-1-amino-2-ethylbutyl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylic acid (PubChem CID 24876038) has the molecular formula C13H26N4O3 and a molecular weight of 286.38 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[(1S)-1-amino-2-ethylbutyl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-[(1S)-1-amino-2-ethylbutyl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 24876038 |
| Molecular Formula | C13H26N4O3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (1S,2S,3S,4R)-3-[(1S)-1-amino-2-ethylbutyl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylic acid |
| SMILES | CCC(CC)[C@H](N)[C@@H]1[C@H](O)[C@@H](C(=O)O)C[C@H]1N=C(N)N |
| InChI | InChI=1S/C13H26N4O3/c1-3-6(4-2)10(14)9-8(17-13(15)16)5-7(11(9)18)12(19)20/h6-11,18H,3-5,14H2,1-2H3,(H,19,20)(H4,15,16,17)/t7-,8+,9+,10-,11+/m0/s1 |
| InChIKey | ZFBIVTNZVJRCKE-UNQZSWDGSA-N |
| XLogP | -0.53 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|