C15H28N4O4 — CID 174580183
(1S,2S,3S,4R)-3-[(3S)-6-amino-4-ethyl-2-oxohexan-3-yl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylic acid (PubChem CID 174580183) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-[(3S)-6-amino-4-ethyl-2-oxohexan-3-yl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-[(3S)-6-amino-4-ethyl-2-oxohexan-3-yl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 174580183 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (1S,2S,3S,4R)-3-[(3S)-6-amino-4-ethyl-2-oxohexan-3-yl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylic acid |
| SMILES | CCC(CCN)[C@H](C(C)=O)[C@@H]1[C@H](O)[C@@H](C(=O)O)C[C@H]1N=C(N)N |
| InChI | InChI=1S/C15H28N4O4/c1-3-8(4-5-16)11(7(2)20)12-10(19-15(17)18)6-9(13(12)21)14(22)23/h8-13,21H,3-6,16H2,1-2H3,(H,22,23)(H4,17,18,19)/t8?,9-,10+,11-,12+,13+/m0/s1 |
| InChIKey | MWLUAZYCWJLFQI-UTCMLXETSA-N |
| XLogP | -0.71 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|