C8H15N3O3 — CID 123669819
4-(diaminomethylideneamino)-2-hydroxy-3-methylcyclopentane-1-carboxylic acid (PubChem CID 123669819) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-2-hydroxy-3-methylcyclopentane-1-carboxylic acid.
| Compound Name | 4-(diaminomethylideneamino)-2-hydroxy-3-methylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 123669819 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 4-(diaminomethylideneamino)-2-hydroxy-3-methylcyclopentane-1-carboxylic acid |
| SMILES | CC1C(N=C(N)N)CC(C(=O)O)C1O |
| InChI | InChI=1S/C8H15N3O3/c1-3-5(11-8(9)10)2-4(6(3)12)7(13)14/h3-6,12H,2H2,1H3,(H,13,14)(H4,9,10,11) |
| InChIKey | VYCQITKRPYTTEP-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|