C13H23IN4O6S — CID 166677159
(1R,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-iodosulfanylcyclopentane-1-carboxylic acid (PubChem CID 166677159) has the molecular formula C13H23IN4O6S and a molecular weight of 490.32 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-iodosulfanylcyclopentane-1-carboxylic acid.
| Compound Name | (1R,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-iodosulfanylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 166677159 |
| Molecular Formula | C13H23IN4O6S |
| Molecular Weight | 490.32 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | (1R,2S,3S,4R)-3-[(1S,2R,3S)-1-acetamido-2,3,4-trihydroxybutyl]-4-(diaminomethylideneamino)-2-iodosulfanylcyclopentane-1-carboxylic acid |
| SMILES | CC(=O)N[C@H]([C@@H](O)[C@@H](O)CO)[C@@H]1[C@H](SI)[C@@H](C(=O)O)C[C@H]1N=C(N)N |
| InChI | InChI=1S/C13H23IN4O6S/c1-4(20)17-9(10(22)7(21)3-19)8-6(18-13(15)16)2-5(12(23)24)11(8)25-14/h5-11,19,21-22H,2-3H2,1H3,(H,17,20)(H,23,24)(H4,15,16,18)/t5-,6+,7-,8+,9-,10-,11+/m0/s1 |
| InChIKey | QUAUXYYMUMSDFM-GEPBSXRESA-N |
| XLogP | -1.98 |
| TPSA | 191.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.32 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|