C27H45NO6 — CID 162944812
methyl (2S)-1-[[(3S,4R,5S)-4-hydroxy-5-methyl-2-oxo-5-[(E)-pentadec-4-enyl]oxolan-3-yl]methyl]-5-oxopyrrolidine-2-carboxylate (PubChem CID 162944812) has the molecular formula C27H45NO6 and a molecular weight of 479.66 g/mol. Its IUPAC name is methyl (2S)-1-[[(3S,4R,5S)-4-hydroxy-5-methyl-2-oxo-5-[(E)-pentadec-4-enyl]oxolan-3-yl]methyl]-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[[(3S,4R,5S)-4-hydroxy-5-methyl-2-oxo-5-[(E)-pentadec-4-enyl]oxolan-3-yl]methyl]-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 162944812 |
| Molecular Formula | C27H45NO6 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.32 |
| IUPAC Name | methyl (2S)-1-[[(3S,4R,5S)-4-hydroxy-5-methyl-2-oxo-5-[(E)-pentadec-4-enyl]oxolan-3-yl]methyl]-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCCC/C=C/CCC[C@]1(C)OC(=O)[C@@H](CN2C(=O)CC[C@H]2C(=O)OC)[C@H]1O |
| InChI | InChI=1S/C27H45NO6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-19-27(2)24(30)21(25(31)34-27)20-28-22(26(32)33-3)17-18-23(28)29/h13-14,21-22,24,30H,4-12,15-20H2,1-3H3/b14-13+/t21-,22-,24+,27-/m0/s1 |
| InChIKey | RJWAXRBINWCTDA-DFIBTMIMSA-N |
| XLogP | 4.70 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|