C20H33NO4 — CID 134846831
tert-butyl (6S,7R,8R)-7-[(E)-hept-5-enyl]-7-hydroxy-6-methyl-5-oxo-1,2,3,6-tetrahydropyrrolizine-8-carboxylate (PubChem CID 134846831) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl (6S,7R,8R)-7-[(E)-hept-5-enyl]-7-hydroxy-6-methyl-5-oxo-1,2,3,6-tetrahydropyrrolizine-8-carboxylate.
| Compound Name | tert-butyl (6S,7R,8R)-7-[(E)-hept-5-enyl]-7-hydroxy-6-methyl-5-oxo-1,2,3,6-tetrahydropyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 134846831 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | tert-butyl (6S,7R,8R)-7-[(E)-hept-5-enyl]-7-hydroxy-6-methyl-5-oxo-1,2,3,6-tetrahydropyrrolizine-8-carboxylate |
| SMILES | C/C=C/CCCC[C@@]1(O)[C@H](C)C(=O)N2CCC[C@@]21C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33NO4/c1-6-7-8-9-10-13-20(24)15(2)16(22)21-14-11-12-19(20,21)17(23)25-18(3,4)5/h6-7,15,24H,8-14H2,1-5H3/b7-6+/t15-,19+,20-/m1/s1 |
| InChIKey | BZDRMDYZLPSGOE-JJUYHHJVSA-N |
| XLogP | 3.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|