C30H40N4O9S — CID 143731970
methyl 3-[[(1R,3R,4R)-3-[[1-(cyclopropylsulfonylcarbamoyl)cyclopropyl]carbamoyl]-4-[hex-5-enyl(methyl)carbamoyl]cyclopentyl]oxycarbonylamino]benzoate (PubChem CID 143731970) has the molecular formula C30H40N4O9S and a molecular weight of 632.74 g/mol. Its IUPAC name is methyl 3-[[(1R,3R,4R)-3-[[1-(cyclopropylsulfonylcarbamoyl)cyclopropyl]carbamoyl]-4-[hex-5-enyl(methyl)carbamoyl]cyclopentyl]oxycarbonylamino]benzoate.
| Compound Name | methyl 3-[[(1R,3R,4R)-3-[[1-(cyclopropylsulfonylcarbamoyl)cyclopropyl]carbamoyl]-4-[hex-5-enyl(methyl)carbamoyl]cyclopentyl]oxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 143731970 |
| Molecular Formula | C30H40N4O9S |
| Molecular Weight | 632.74 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | methyl 3-[[(1R,3R,4R)-3-[[1-(cyclopropylsulfonylcarbamoyl)cyclopropyl]carbamoyl]-4-[hex-5-enyl(methyl)carbamoyl]cyclopentyl]oxycarbonylamino]benzoate |
| SMILES | C=CCCCCN(C)C(=O)[C@@H]1C[C@H](OC(=O)Nc2cccc(C(=O)OC)c2)C[C@H]1C(=O)NC1(C(=O)NS(=O)(=O)C2CC2)CC1 |
| InChI | InChI=1S/C30H40N4O9S/c1-4-5-6-7-15-34(2)26(36)24-18-21(43-29(39)31-20-10-8-9-19(16-20)27(37)42-3)17-23(24)25(35)32-30(13-14-30)28(38)33-44(40,41)22-11-12-22/h4,8-10,16,21-24H,1,5-7,11-15,17-18H2,2-3H3,(H,31,39)(H,32,35)(H,33,38)/t21-,23-,24-/m1/s1 |
| InChIKey | ROJADJMJRHEVAV-GMKZXUHWSA-N |
| XLogP | 2.49 |
| TPSA | 177.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.74 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|