C22H29NO5 — CID 123373671
[3-[hex-5-enyl(methyl)carbamoyl]-4-methoxycarbonylcyclopentyl] benzoate (PubChem CID 123373671) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is [3-[hex-5-enyl(methyl)carbamoyl]-4-methoxycarbonylcyclopentyl] benzoate.
| Compound Name | [3-[hex-5-enyl(methyl)carbamoyl]-4-methoxycarbonylcyclopentyl] benzoate |
|---|---|
| PubChem CID | 123373671 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | [3-[hex-5-enyl(methyl)carbamoyl]-4-methoxycarbonylcyclopentyl] benzoate |
| SMILES | C=CCCCCN(C)C(=O)C1CC(OC(=O)c2ccccc2)CC1C(=O)OC |
| InChI | InChI=1S/C22H29NO5/c1-4-5-6-10-13-23(2)20(24)18-14-17(15-19(18)22(26)27-3)28-21(25)16-11-8-7-9-12-16/h4,7-9,11-12,17-19H,1,5-6,10,13-15H2,2-3H3 |
| InChIKey | ZTVUPLXSYOCJFH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|