C22H22O7 — CID 10046407
[(1R,2S,3R,5R)-2-benzoyloxy-5-(hydroxymethyl)-3-methoxycarbonylcyclopentyl] benzoate (PubChem CID 10046407) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is [(1R,2S,3R,5R)-2-benzoyloxy-5-(hydroxymethyl)-3-methoxycarbonylcyclopentyl] benzoate.
| Compound Name | [(1R,2S,3R,5R)-2-benzoyloxy-5-(hydroxymethyl)-3-methoxycarbonylcyclopentyl] benzoate |
|---|---|
| PubChem CID | 10046407 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [(1R,2S,3R,5R)-2-benzoyloxy-5-(hydroxymethyl)-3-methoxycarbonylcyclopentyl] benzoate |
| SMILES | COC(=O)[C@@H]1C[C@H](CO)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22O7/c1-27-22(26)17-12-16(13-23)18(28-20(24)14-8-4-2-5-9-14)19(17)29-21(25)15-10-6-3-7-11-15/h2-11,16-19,23H,12-13H2,1H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | IJASXNGVXZNZFX-MKXGPGLRSA-N |
| XLogP | 2.24 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|