C20H28N4O5S — CID 129082452
[(3R,5S)-5-[[(1R,2S)-2-ethenyl-1-[(2-methylcyclopropyl)sulfonylcarbamoyl]cyclopropyl]carbamoyl]pyrrolidin-3-yl] 2-methylidenebut-3-enimidate (PubChem CID 129082452) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is [(3R,5S)-5-[[(1R,2S)-2-ethenyl-1-[(2-methylcyclopropyl)sulfonylcarbamoyl]cyclopropyl]carbamoyl]pyrrolidin-3-yl] 2-methylidenebut-3-enimidate.
| Compound Name | [(3R,5S)-5-[[(1R,2S)-2-ethenyl-1-[(2-methylcyclopropyl)sulfonylcarbamoyl]cyclopropyl]carbamoyl]pyrrolidin-3-yl] 2-methylidenebut-3-enimidate |
|---|---|
| PubChem CID | 129082452 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | [(3R,5S)-5-[[(1R,2S)-2-ethenyl-1-[(2-methylcyclopropyl)sulfonylcarbamoyl]cyclopropyl]carbamoyl]pyrrolidin-3-yl] 2-methylidenebut-3-enimidate |
| SMILES | [H]/N=C(/O[C@H]1CN[C@H](C(=O)N[C@]2(C(=O)NS(=O)(=O)C3CC3C)C[C@H]2C=C)C1)C(=C)C=C |
| InChI | InChI=1S/C20H28N4O5S/c1-5-11(3)17(21)29-14-8-15(22-10-14)18(25)23-20(9-13(20)6-2)19(26)24-30(27,28)16-7-12(16)4/h5-6,12-16,21-22H,1-3,7-10H2,4H3,(H,23,25)(H,24,26)/b21-17+/t12?,13-,14-,15+,16?,20-/m1/s1 |
| InChIKey | NQXQYLSBXKYJQV-OMGUEJKCSA-N |
| XLogP | 0.37 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|