C18H26N2O3S — CID 59009583
trans-(1S,2S)-1-tert-butyl-N-[2-(dimethylamino)phenyl]sulfonyl-2-ethenylcyclopropane-1-carboxamide (PubChem CID 59009583) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is trans-(1S,2S)-1-tert-butyl-N-[2-(dimethylamino)phenyl]sulfonyl-2-ethenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-1-tert-butyl-N-[2-(dimethylamino)phenyl]sulfonyl-2-ethenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59009583 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | trans-(1S,2S)-1-tert-butyl-N-[2-(dimethylamino)phenyl]sulfonyl-2-ethenylcyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)c1ccccc1N(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H26N2O3S/c1-7-13-12-18(13,17(2,3)4)16(21)19-24(22,23)15-11-9-8-10-14(15)20(5)6/h7-11,13H,1,12H2,2-6H3,(H,19,21)/t13-,18-/m1/s1 |
| InChIKey | JDILVVVDCRCCSA-FZKQIMNGSA-N |
| XLogP | 2.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|