C33H51N3O14S — CID 160901717
methyl 3-[2-[2-[2-[[(1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropanecarbonyl]sulfamoyl]anilino]ethoxy]ethoxy]propanoate;methyl 3-[2-(2-oxoethoxy)ethoxy]propanoate (PubChem CID 160901717) has the molecular formula C33H51N3O14S and a molecular weight of 745.84 g/mol. Its IUPAC name is methyl 3-[2-[2-[2-[[(1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropanecarbonyl]sulfamoyl]anilino]ethoxy]ethoxy]propanoate;methyl 3-[2-(2-oxoethoxy)ethoxy]propanoate.
| Compound Name | methyl 3-[2-[2-[2-[[(1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropanecarbonyl]sulfamoyl]anilino]ethoxy]ethoxy]propanoate;methyl 3-[2-(2-oxoethoxy)ethoxy]propanoate |
|---|---|
| PubChem CID | 160901717 |
| Molecular Formula | C33H51N3O14S |
| Molecular Weight | 745.84 g/mol |
| Exact Mass | 745.31 |
| IUPAC Name | methyl 3-[2-[2-[2-[[(1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropanecarbonyl]sulfamoyl]anilino]ethoxy]ethoxy]propanoate;methyl 3-[2-(2-oxoethoxy)ethoxy]propanoate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)OC(C)(C)C)C(=O)NS(=O)(=O)c1ccccc1NCCOCCOCCC(=O)OC.COC(=O)CCOCCOCC=O |
| InChI | InChI=1S/C25H37N3O9S.C8H14O5/c1-6-18-17-25(18,27-23(31)37-24(2,3)4)22(30)28-38(32,33)20-10-8-7-9-19(20)26-12-14-36-16-15-35-13-11-21(29)34-5;1-11-8(10)2-4-12-6-7-13-5-3-9/h6-10,18,26H,1,11-17H2,2-5H3,(H,27,31)(H,28,30);3H,2,4-7H2,1H3/t18-,25-;/m1./s1 |
| InChIKey | SPPBCBPLNQZLHO-IISBEVRKSA-N |
| XLogP | 1.75 |
| TPSA | 220.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.84 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|