About trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide
trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide (PubChem CID 143563480) has the molecular formula C14H16N2O4S
and a molecular weight of 308.36 g/mol. Its IUPAC name is trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide |
| PubChem CID | 143563480 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1C[C@@H]1C(=O)NS(=O)(=O)c1ccccc1NC(C)=O |
| InChI | InChI=1S/C14H16N2O4S/c1-3-10-8-11(10)14(18)16-21(19,20)13-7-5-4-6-12(13)15-9(2)17/h3-7,10-11H,1,8H2,2H3,(H,15,17)(H,16,18)/t10-,11+/m1/s1 |
| InChIKey | CJBVTBZXLAWPHC-MNOVXSKESA-N |
| XLogP | 1.27 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide?
The IUPAC name of trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide (CID 143563480) is trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide.
What is the SMILES notation for trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide?
The canonical SMILES for trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide is C=C[C@@H]1C[C@@H]1C(=O)NS(=O)(=O)c1ccccc1NC(C)=O.
What is the InChIKey of trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide?
The InChIKey is CJBVTBZXLAWPHC-MNOVXSKESA-N. The full InChI is InChI=1S/C14H16N2O4S/c1-3-10-8-11(10)14(18)16-21(19,20)13-7-5-4-6-12(13)15-9(2)17/h3-7,10-11H,1,8H2,2H3,(H,15,17)(H,16,18)/t10-,11+/m1/s1.
What are the key properties of trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide?
trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide has a molecular weight of 308.36 g/mol, XLogP of 1.27, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-N-(2-acetamidophenyl)sulfonyl-2-ethenylcyclopropane-1-carboxamide is sourced from PubChem (CID 143563480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).