C9H17ClN2O3S — CID 159200705
azanium;cis-(1R,2S)-N-cyclopropylsulfonyl-2-ethenylcyclopropane-1-carboxamide;chloride (PubChem CID 159200705) has the molecular formula C9H17ClN2O3S and a molecular weight of 268.77 g/mol. Its IUPAC name is azanium;cis-(1R,2S)-N-cyclopropylsulfonyl-2-ethenylcyclopropane-1-carboxamide;chloride.
| Compound Name | azanium;cis-(1R,2S)-N-cyclopropylsulfonyl-2-ethenylcyclopropane-1-carboxamide;chloride |
|---|---|
| PubChem CID | 159200705 |
| Molecular Formula | C9H17ClN2O3S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | azanium;cis-(1R,2S)-N-cyclopropylsulfonyl-2-ethenylcyclopropane-1-carboxamide;chloride |
| SMILES | C=C[C@@H]1C[C@H]1C(=O)NS(=O)(=O)C1CC1.[Cl-].[NH4+] |
| InChI | InChI=1S/C9H13NO3S.ClH.H3N/c1-2-6-5-8(6)9(11)10-14(12,13)7-3-4-7;;/h2,6-8H,1,3-5H2,(H,10,11);1H;1H3/t6-,8-;;/m1../s1 |
| InChIKey | PHBARPSGFPUGML-QGTMZHJHSA-N |
| XLogP | -2.20 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|