C22H22N2O5S — CID 21308094
(4S,7S,12bS)-5-oxo-4-(phenylmethoxycarbonylamino)-2,3,4,7,8,12b-hexahydro-[1,3]thiazepino[2,3-a]isoquinoline-7-carboxylic acid (PubChem CID 21308094) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is (4S,7S,12bS)-5-oxo-4-(phenylmethoxycarbonylamino)-2,3,4,7,8,12b-hexahydro-[1,3]thiazepino[2,3-a]isoquinoline-7-carboxylic acid.
| Compound Name | (4S,7S,12bS)-5-oxo-4-(phenylmethoxycarbonylamino)-2,3,4,7,8,12b-hexahydro-[1,3]thiazepino[2,3-a]isoquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 21308094 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (4S,7S,12bS)-5-oxo-4-(phenylmethoxycarbonylamino)-2,3,4,7,8,12b-hexahydro-[1,3]thiazepino[2,3-a]isoquinoline-7-carboxylic acid |
| SMILES | O=C(N[C@H]1CCS[C@H]2c3ccccc3C[C@@H](C(=O)O)N2C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H22N2O5S/c25-19-17(23-22(28)29-13-14-6-2-1-3-7-14)10-11-30-20-16-9-5-4-8-15(16)12-18(21(26)27)24(19)20/h1-9,17-18,20H,10-13H2,(H,23,28)(H,26,27)/t17-,18-,20-/m0/s1 |
| InChIKey | UATALGWLCGXPTH-BJLQDIEVSA-N |
| XLogP | 2.95 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |