C23H33N3O6 — CID 10288304
(2S)-2-[(3S,7S)-3-[[2-benzyl-4-(hydroxyamino)-4-oxobutanoyl]amino]-2-oxo-7-propylazepan-1-yl]propanoic acid (PubChem CID 10288304) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is (2S)-2-[(3S,7S)-3-[[2-benzyl-4-(hydroxyamino)-4-oxobutanoyl]amino]-2-oxo-7-propylazepan-1-yl]propanoic acid.
| Compound Name | (2S)-2-[(3S,7S)-3-[[2-benzyl-4-(hydroxyamino)-4-oxobutanoyl]amino]-2-oxo-7-propylazepan-1-yl]propanoic acid |
|---|---|
| PubChem CID | 10288304 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (2S)-2-[(3S,7S)-3-[[2-benzyl-4-(hydroxyamino)-4-oxobutanoyl]amino]-2-oxo-7-propylazepan-1-yl]propanoic acid |
| SMILES | CCC[C@H]1CCC[C@H](NC(=O)C(CC(=O)NO)Cc2ccccc2)C(=O)N1[C@@H](C)C(=O)O |
| InChI | InChI=1S/C23H33N3O6/c1-3-8-18-11-7-12-19(22(29)26(18)15(2)23(30)31)24-21(28)17(14-20(27)25-32)13-16-9-5-4-6-10-16/h4-6,9-10,15,17-19,32H,3,7-8,11-14H2,1-2H3,(H,24,28)(H,25,27)(H,30,31)/t15-,17?,18-,19-/m0/s1 |
| InChIKey | DVELFNNVWLFTLA-FYWHIHEHSA-N |
| XLogP | 1.88 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|