C27H28N2O5 — CID 87931717
N'-hydroxy-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-2-[(4-phenylmethoxyphenyl)methyl]butanediamide (PubChem CID 87931717) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is N'-hydroxy-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-2-[(4-phenylmethoxyphenyl)methyl]butanediamide.
| Compound Name | N'-hydroxy-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-2-[(4-phenylmethoxyphenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 87931717 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N'-hydroxy-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-2-[(4-phenylmethoxyphenyl)methyl]butanediamide |
| SMILES | O=C(CC(Cc1ccc(OCc2ccccc2)cc1)C(=O)NC1c2ccccc2CC1O)NO |
| InChI | InChI=1S/C27H28N2O5/c30-24-15-20-8-4-5-9-23(20)26(24)28-27(32)21(16-25(31)29-33)14-18-10-12-22(13-11-18)34-17-19-6-2-1-3-7-19/h1-13,21,24,26,30,33H,14-17H2,(H,28,32)(H,29,31) |
| InChIKey | NIFBZMMGYWKNIM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|