C26H24ClFN2O4 — CID 87931649
(2R)-2-[[4-(3-chloro-4-fluorophenyl)phenyl]methyl]-N'-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanediamide (PubChem CID 87931649) has the molecular formula C26H24ClFN2O4 and a molecular weight of 482.94 g/mol. Its IUPAC name is (2R)-2-[[4-(3-chloro-4-fluorophenyl)phenyl]methyl]-N'-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanediamide.
| Compound Name | (2R)-2-[[4-(3-chloro-4-fluorophenyl)phenyl]methyl]-N'-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanediamide |
|---|---|
| PubChem CID | 87931649 |
| Molecular Formula | C26H24ClFN2O4 |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (2R)-2-[[4-(3-chloro-4-fluorophenyl)phenyl]methyl]-N'-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanediamide |
| SMILES | O=C(C[C@@H](Cc1ccc(-c2ccc(F)c(Cl)c2)cc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O)NO |
| InChI | InChI=1S/C26H24ClFN2O4/c27-21-12-17(9-10-22(21)28)16-7-5-15(6-8-16)11-19(14-24(32)30-34)26(33)29-25-20-4-2-1-3-18(20)13-23(25)31/h1-10,12,19,23,25,31,34H,11,13-14H2,(H,29,33)(H,30,32)/t19-,23-,25+/m1/s1 |
| InChIKey | KKEGVCYPTAVMIQ-NIDLKEISSA-N |
| XLogP | 3.97 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|