C34H41NO6 — CID 67770599
tert-butyl (3R,4S,6S)-3-benzyl-4-hydroxy-7-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-[(4-hydroxyphenyl)methyl]-7-oxoheptanoate (PubChem CID 67770599) has the molecular formula C34H41NO6 and a molecular weight of 559.70 g/mol. Its IUPAC name is tert-butyl (3R,4S,6S)-3-benzyl-4-hydroxy-7-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-[(4-hydroxyphenyl)methyl]-7-oxoheptanoate.
| Compound Name | tert-butyl (3R,4S,6S)-3-benzyl-4-hydroxy-7-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-[(4-hydroxyphenyl)methyl]-7-oxoheptanoate |
|---|---|
| PubChem CID | 67770599 |
| Molecular Formula | C34H41NO6 |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | tert-butyl (3R,4S,6S)-3-benzyl-4-hydroxy-7-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-6-[(4-hydroxyphenyl)methyl]-7-oxoheptanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccc(O)cc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C34H41NO6/c1-34(2,3)41-31(39)21-25(17-22-9-5-4-6-10-22)29(37)20-26(18-23-13-15-27(36)16-14-23)33(40)35-32-28-12-8-7-11-24(28)19-30(32)38/h4-16,25-26,29-30,32,36-38H,17-21H2,1-3H3,(H,35,40)/t25-,26+,29+,30-,32+/m1/s1 |
| InChIKey | ZQYIIMLETWFJIW-UERHNCLNSA-N |
| XLogP | 4.67 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |