C29H33NO5 — CID 5480793
(2R,4S)-2-benzyl-4-hydroxy-N-[(2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5-[2-(methoxymethoxy)phenyl]pentanamide (PubChem CID 5480793) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is (2R,4S)-2-benzyl-4-hydroxy-N-[(2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5-[2-(methoxymethoxy)phenyl]pentanamide.
| Compound Name | (2R,4S)-2-benzyl-4-hydroxy-N-[(2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5-[2-(methoxymethoxy)phenyl]pentanamide |
|---|---|
| PubChem CID | 5480793 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (2R,4S)-2-benzyl-4-hydroxy-N-[(2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5-[2-(methoxymethoxy)phenyl]pentanamide |
| SMILES | COCOc1ccccc1C[C@@H](O)C[C@@H](Cc1ccccc1)C(=O)NC1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C29H33NO5/c1-34-19-35-27-14-8-6-12-22(27)16-24(31)17-23(15-20-9-3-2-4-10-20)29(33)30-28-25-13-7-5-11-21(25)18-26(28)32/h2-14,23-24,26,28,31-32H,15-19H2,1H3,(H,30,33)/t23-,24-,26-,28?/m1/s1 |
| InChIKey | GXMYJDJUGLWQHB-PQJAERKNSA-N |
| XLogP | 3.60 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|