C29H34N2O4S — CID 144626010
2-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-4-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfanylamino]pentanamide (PubChem CID 144626010) has the molecular formula C29H34N2O4S and a molecular weight of 506.67 g/mol. Its IUPAC name is 2-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-4-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfanylamino]pentanamide.
| Compound Name | 2-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-4-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfanylamino]pentanamide |
|---|---|
| PubChem CID | 144626010 |
| Molecular Formula | C29H34N2O4S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 2-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-4-(hydroxymethyl)-5-[(4-methoxyphenyl)sulfanylamino]pentanamide |
| SMILES | COc1ccc(SNCC(CO)CC(Cc2ccccc2)C(=O)NC2c3ccccc3CC2O)cc1 |
| InChI | InChI=1S/C29H34N2O4S/c1-35-24-11-13-25(14-12-24)36-30-18-21(19-32)16-23(15-20-7-3-2-4-8-20)29(34)31-28-26-10-6-5-9-22(26)17-27(28)33/h2-14,21,23,27-28,30,32-33H,15-19H2,1H3,(H,31,34) |
| InChIKey | XTZSHEZZEBIKJU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|