C31H35N3O4S — CID 144626157
[1-[[5-[(4-acetamidophenyl)sulfanylamino]-2-benzylpentanoyl]amino]-2,3-dihydro-1H-inden-2-yl] acetate (PubChem CID 144626157) has the molecular formula C31H35N3O4S and a molecular weight of 545.71 g/mol. Its IUPAC name is [1-[[5-[(4-acetamidophenyl)sulfanylamino]-2-benzylpentanoyl]amino]-2,3-dihydro-1H-inden-2-yl] acetate.
| Compound Name | [1-[[5-[(4-acetamidophenyl)sulfanylamino]-2-benzylpentanoyl]amino]-2,3-dihydro-1H-inden-2-yl] acetate |
|---|---|
| PubChem CID | 144626157 |
| Molecular Formula | C31H35N3O4S |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | [1-[[5-[(4-acetamidophenyl)sulfanylamino]-2-benzylpentanoyl]amino]-2,3-dihydro-1H-inden-2-yl] acetate |
| SMILES | CC(=O)Nc1ccc(SNCCCC(Cc2ccccc2)C(=O)NC2c3ccccc3CC2OC(C)=O)cc1 |
| InChI | InChI=1S/C31H35N3O4S/c1-21(35)33-26-14-16-27(17-15-26)39-32-18-8-12-25(19-23-9-4-3-5-10-23)31(37)34-30-28-13-7-6-11-24(28)20-29(30)38-22(2)36/h3-7,9-11,13-17,25,29-30,32H,8,12,18-20H2,1-2H3,(H,33,35)(H,34,37) |
| InChIKey | IVFACYXULSHOQC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|