C32H37N3O6S — CID 123298962
5-[(4-acetamidophenyl)sulfonylamino]-2-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-4-prop-1-en-2-yloxypentanamide (PubChem CID 123298962) has the molecular formula C32H37N3O6S and a molecular weight of 591.73 g/mol. Its IUPAC name is 5-[(4-acetamidophenyl)sulfonylamino]-2-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-4-prop-1-en-2-yloxypentanamide.
| Compound Name | 5-[(4-acetamidophenyl)sulfonylamino]-2-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-4-prop-1-en-2-yloxypentanamide |
|---|---|
| PubChem CID | 123298962 |
| Molecular Formula | C32H37N3O6S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | 5-[(4-acetamidophenyl)sulfonylamino]-2-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-4-prop-1-en-2-yloxypentanamide |
| SMILES | C=C(C)OC(CNS(=O)(=O)c1ccc(NC(C)=O)cc1)CC(Cc1ccccc1)C(=O)NC1c2ccccc2CC1O |
| InChI | InChI=1S/C32H37N3O6S/c1-21(2)41-27(20-33-42(39,40)28-15-13-26(14-16-28)34-22(3)36)18-25(17-23-9-5-4-6-10-23)32(38)35-31-29-12-8-7-11-24(29)19-30(31)37/h4-16,25,27,30-31,33,37H,1,17-20H2,2-3H3,(H,34,36)(H,35,38) |
| InChIKey | ISAINBDDJYPXBB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|