C30H34N2O5S — CID 118334911
(2R,4S)-2-benzyl-5-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide (PubChem CID 118334911) has the molecular formula C30H34N2O5S and a molecular weight of 534.68 g/mol. Its IUPAC name is (2R,4S)-2-benzyl-5-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide.
| Compound Name | (2R,4S)-2-benzyl-5-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide |
|---|---|
| PubChem CID | 118334911 |
| Molecular Formula | C30H34N2O5S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | (2R,4S)-2-benzyl-5-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide |
| SMILES | O=C(N[C@H]1c2ccccc2C[C@H]1O)[C@H](Cc1ccccc1)C[C@H](O)CNS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C30H34N2O5S/c33-25(19-31-38(36,37)26-14-13-21-10-6-11-22(21)17-26)16-24(15-20-7-2-1-3-8-20)30(35)32-29-27-12-5-4-9-23(27)18-28(29)34/h1-5,7-9,12-14,17,24-25,28-29,31,33-34H,6,10-11,15-16,18-19H2,(H,32,35)/t24-,25+,28-,29+/m1/s1 |
| InChIKey | ZMLFCKSGZUYTOS-BVIJCPSYSA-N |
| XLogP | 2.84 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |