C31H36N2O7S — CID 118334927
(2R,4S)-2-benzyl-5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-4-methoxy-N-[(1S,2R)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pentanamide (PubChem CID 118334927) has the molecular formula C31H36N2O7S and a molecular weight of 580.70 g/mol. Its IUPAC name is (2R,4S)-2-benzyl-5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-4-methoxy-N-[(1S,2R)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pentanamide.
| Compound Name | (2R,4S)-2-benzyl-5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-4-methoxy-N-[(1S,2R)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pentanamide |
|---|---|
| PubChem CID | 118334927 |
| Molecular Formula | C31H36N2O7S |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | (2R,4S)-2-benzyl-5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-4-methoxy-N-[(1S,2R)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pentanamide |
| SMILES | CO[C@H](CNS(=O)(=O)c1ccc2c(c1)OCCO2)C[C@@H](Cc1ccccc1)C(=O)N[C@H]1c2ccccc2C[C@H]1OC |
| InChI | InChI=1S/C31H36N2O7S/c1-37-24(20-32-41(35,36)25-12-13-27-28(19-25)40-15-14-39-27)17-23(16-21-8-4-3-5-9-21)31(34)33-30-26-11-7-6-10-22(26)18-29(30)38-2/h3-13,19,23-24,29-30,32H,14-18,20H2,1-2H3,(H,33,34)/t23-,24+,29-,30+/m1/s1 |
| InChIKey | HXKBAJWCYJDSBA-SMVSGJMUSA-N |
| XLogP | 3.43 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |