C35H42N2O5 — CID 67770482
(3R,5S,6S)-6-benzyl-N'-cyclopropyl-5-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[(4-hydroxyphenyl)methyl]nonanediamide (PubChem CID 67770482) has the molecular formula C35H42N2O5 and a molecular weight of 570.73 g/mol. Its IUPAC name is (3R,5S,6S)-6-benzyl-N'-cyclopropyl-5-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[(4-hydroxyphenyl)methyl]nonanediamide.
| Compound Name | (3R,5S,6S)-6-benzyl-N'-cyclopropyl-5-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[(4-hydroxyphenyl)methyl]nonanediamide |
|---|---|
| PubChem CID | 67770482 |
| Molecular Formula | C35H42N2O5 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | (3R,5S,6S)-6-benzyl-N'-cyclopropyl-5-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-[(4-hydroxyphenyl)methyl]nonanediamide |
| SMILES | O=C(CC[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](CC(=O)N[C@H]1c2ccccc2C[C@H]1O)Cc1ccc(O)cc1)NC1CC1 |
| InChI | InChI=1S/C35H42N2O5/c38-29-15-10-24(11-16-29)18-25(21-34(42)37-35-30-9-5-4-8-26(30)22-32(35)40)20-31(39)27(19-23-6-2-1-3-7-23)12-17-33(41)36-28-13-14-28/h1-11,15-16,25,27-28,31-32,35,38-40H,12-14,17-22H2,(H,36,41)(H,37,42)/t25-,27+,31+,32-,35+/m1/s1 |
| InChIKey | LJMMUTIENOLUPO-HBWBRTLKSA-N |
| XLogP | 4.38 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |