C33H39ClN4O7S — CID 18465693
tert-butyl 3-[(7-benzamido-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl)amino]-5-[(2-chlorophenyl)methylsulfanyl]-4-oxopentanoate (PubChem CID 18465693) has the molecular formula C33H39ClN4O7S and a molecular weight of 671.22 g/mol. Its IUPAC name is tert-butyl 3-[(7-benzamido-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl)amino]-5-[(2-chlorophenyl)methylsulfanyl]-4-oxopentanoate.
| Compound Name | tert-butyl 3-[(7-benzamido-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl)amino]-5-[(2-chlorophenyl)methylsulfanyl]-4-oxopentanoate |
|---|---|
| PubChem CID | 18465693 |
| Molecular Formula | C33H39ClN4O7S |
| Molecular Weight | 671.22 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | tert-butyl 3-[(7-benzamido-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl)amino]-5-[(2-chlorophenyl)methylsulfanyl]-4-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)CC(NC(=O)C1CCCN2C(=O)CCC(NC(=O)c3ccccc3)C(=O)N12)C(=O)CSCc1ccccc1Cl |
| InChI | InChI=1S/C33H39ClN4O7S/c1-33(2,3)45-29(41)18-25(27(39)20-46-19-22-12-7-8-13-23(22)34)36-31(43)26-14-9-17-37-28(40)16-15-24(32(44)38(26)37)35-30(42)21-10-5-4-6-11-21/h4-8,10-13,24-26H,9,14-20H2,1-3H3,(H,35,42)(H,36,43) |
| InChIKey | FRKYWEJOXKWPLJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |