C23H28N4O7 — CID 59947819
ethyl (3S)-3-[[(4S,7S)-7-benzamido-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoate (PubChem CID 59947819) has the molecular formula C23H28N4O7 and a molecular weight of 472.50 g/mol. Its IUPAC name is ethyl (3S)-3-[[(4S,7S)-7-benzamido-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoate.
| Compound Name | ethyl (3S)-3-[[(4S,7S)-7-benzamido-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 59947819 |
| Molecular Formula | C23H28N4O7 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | ethyl (3S)-3-[[(4S,7S)-7-benzamido-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)C[C@@H](C=O)NC(=O)[C@@H]1CCCN2C(=O)CC[C@H](NC(=O)c3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C23H28N4O7/c1-2-34-20(30)13-16(14-28)24-22(32)18-9-6-12-26-19(29)11-10-17(23(33)27(18)26)25-21(31)15-7-4-3-5-8-15/h3-5,7-8,14,16-18H,2,6,9-13H2,1H3,(H,24,32)(H,25,31)/t16-,17-,18-/m0/s1 |
| InChIKey | HYXIGRMOGLIMAL-BZSNNMDCSA-N |
| XLogP | -0.05 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|