C23H28N4O7 — CID 20670321
N-(1,4-dioxopentan-2-yl)-7-[(4-methoxybenzoyl)amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide (PubChem CID 20670321) has the molecular formula C23H28N4O7 and a molecular weight of 472.50 g/mol. Its IUPAC name is N-(1,4-dioxopentan-2-yl)-7-[(4-methoxybenzoyl)amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide.
| Compound Name | N-(1,4-dioxopentan-2-yl)-7-[(4-methoxybenzoyl)amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 20670321 |
| Molecular Formula | C23H28N4O7 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-(1,4-dioxopentan-2-yl)-7-[(4-methoxybenzoyl)amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
| SMILES | COc1ccc(C(=O)NC2CCC(=O)N3CCCC(C(=O)NC(C=O)CC(C)=O)N3C2=O)cc1 |
| InChI | InChI=1S/C23H28N4O7/c1-14(29)12-16(13-28)24-22(32)19-4-3-11-26-20(30)10-9-18(23(33)27(19)26)25-21(31)15-5-7-17(34-2)8-6-15/h5-8,13,16,18-19H,3-4,9-12H2,1-2H3,(H,24,32)(H,25,31) |
| InChIKey | LWAUPAAAOZRNTL-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|