C23H26ClN5O7 — CID 59960916
N'-(4-chlorophenyl)-N-[(4S,7S)-4-[[(2S)-1,4-dioxopentan-2-yl]carbamoyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]oxamide (PubChem CID 59960916) has the molecular formula C23H26ClN5O7 and a molecular weight of 519.94 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-N-[(4S,7S)-4-[[(2S)-1,4-dioxopentan-2-yl]carbamoyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]oxamide.
| Compound Name | N'-(4-chlorophenyl)-N-[(4S,7S)-4-[[(2S)-1,4-dioxopentan-2-yl]carbamoyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]oxamide |
|---|---|
| PubChem CID | 59960916 |
| Molecular Formula | C23H26ClN5O7 |
| Molecular Weight | 519.94 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | N'-(4-chlorophenyl)-N-[(4S,7S)-4-[[(2S)-1,4-dioxopentan-2-yl]carbamoyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]oxamide |
| SMILES | CC(=O)C[C@@H](C=O)NC(=O)[C@@H]1CCCN2C(=O)CC[C@H](NC(=O)C(=O)Nc3ccc(Cl)cc3)C(=O)N12 |
| InChI | InChI=1S/C23H26ClN5O7/c1-13(31)11-16(12-30)26-20(33)18-3-2-10-28-19(32)9-8-17(23(36)29(18)28)27-22(35)21(34)25-15-6-4-14(24)5-7-15/h4-7,12,16-18H,2-3,8-11H2,1H3,(H,25,34)(H,26,33)(H,27,35)/t16-,17-,18-/m0/s1 |
| InChIKey | IAHKXUQMUDNSRB-BZSNNMDCSA-N |
| XLogP | -0.05 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.94 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|