C24H29N5O7 — CID 58357082
(3S)-3-[[(4S,7S)-6,10-dioxo-7-[[2-(prop-1-en-2-ylamino)benzoyl]amino]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 58357082) has the molecular formula C24H29N5O7 and a molecular weight of 499.52 g/mol. Its IUPAC name is (3S)-3-[[(4S,7S)-6,10-dioxo-7-[[2-(prop-1-en-2-ylamino)benzoyl]amino]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(4S,7S)-6,10-dioxo-7-[[2-(prop-1-en-2-ylamino)benzoyl]amino]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58357082 |
| Molecular Formula | C24H29N5O7 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | (3S)-3-[[(4S,7S)-6,10-dioxo-7-[[2-(prop-1-en-2-ylamino)benzoyl]amino]-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | C=C(C)Nc1ccccc1C(=O)N[C@H]1CCC(=O)N2CCC[C@@H](C(=O)N[C@H](C=O)CC(=O)O)N2C1=O |
| InChI | InChI=1S/C24H29N5O7/c1-14(2)25-17-7-4-3-6-16(17)22(34)27-18-9-10-20(31)28-11-5-8-19(29(28)24(18)36)23(35)26-15(13-30)12-21(32)33/h3-4,6-7,13,15,18-19,25H,1,5,8-12H2,2H3,(H,26,35)(H,27,34)(H,32,33)/t15-,18-,19-/m0/s1 |
| InChIKey | DEYKKPSRTSAFKS-SNRMKQJTSA-N |
| XLogP | 0.42 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|