C23H28N4O7 — CID 54333035
(3S)-3-[[(4S,7S)-6,10-dioxo-7-(3-phenylpropanoylamino)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 54333035) has the molecular formula C23H28N4O7 and a molecular weight of 472.50 g/mol. Its IUPAC name is (3S)-3-[[(4S,7S)-6,10-dioxo-7-(3-phenylpropanoylamino)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(4S,7S)-6,10-dioxo-7-(3-phenylpropanoylamino)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54333035 |
| Molecular Formula | C23H28N4O7 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (3S)-3-[[(4S,7S)-6,10-dioxo-7-(3-phenylpropanoylamino)-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN2C(=O)CC[C@H](NC(=O)CCc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C23H28N4O7/c28-14-16(13-21(31)32)24-22(33)18-7-4-12-26-20(30)11-9-17(23(34)27(18)26)25-19(29)10-8-15-5-2-1-3-6-15/h1-3,5-6,14,16-18H,4,7-13H2,(H,24,33)(H,25,29)(H,31,32)/t16-,17-,18-/m0/s1 |
| InChIKey | SZRAQYURHCZXOP-BZSNNMDCSA-N |
| XLogP | -0.21 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|